C23H26NO2P — CID 175479837
N-benzyl-N-(1-diphenylphosphorylbutyl)hydroxylamine (PubChem CID 175479837) has the molecular formula C23H26NO2P and a molecular weight of 379.44 g/mol. Its IUPAC name is N-benzyl-N-(1-diphenylphosphorylbutyl)hydroxylamine.
| Compound Name | N-benzyl-N-(1-diphenylphosphorylbutyl)hydroxylamine |
|---|---|
| PubChem CID | 175479837 |
| Molecular Formula | C23H26NO2P |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-benzyl-N-(1-diphenylphosphorylbutyl)hydroxylamine |
| SMILES | CCCC(N(O)Cc1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26NO2P/c1-2-12-23(24(25)19-20-13-6-3-7-14-20)27(26,21-15-8-4-9-16-21)22-17-10-5-11-18-22/h3-11,13-18,23,25H,2,12,19H2,1H3 |
| InChIKey | DPBNEOIHILFPOS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|