C24H33O2P — CID 98040519
(3S,4S)-3-diphenylphosphoryldodec-1-en-4-ol (PubChem CID 98040519) has the molecular formula C24H33O2P and a molecular weight of 384.50 g/mol. Its IUPAC name is (3S,4S)-3-diphenylphosphoryldodec-1-en-4-ol.
| Compound Name | (3S,4S)-3-diphenylphosphoryldodec-1-en-4-ol |
|---|---|
| PubChem CID | 98040519 |
| Molecular Formula | C24H33O2P |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (3S,4S)-3-diphenylphosphoryldodec-1-en-4-ol |
| SMILES | C=C[C@@H]([C@@H](O)CCCCCCCC)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33O2P/c1-3-5-6-7-8-15-20-23(25)24(4-2)27(26,21-16-11-9-12-17-21)22-18-13-10-14-19-22/h4,9-14,16-19,23-25H,2-3,5-8,15,20H2,1H3/t23-,24-/m0/s1 |
| InChIKey | AKQMJCCGNHXSSJ-ZEQRLZLVSA-N |
| XLogP | 5.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|