About 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol
2-(triphenyl-λ5-phosphanylidene)undecan-3-ol (PubChem CID 11743555) has the molecular formula C29H37OP
and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol.
Molecular Properties
| Compound Name | 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol |
| PubChem CID | 11743555 |
| Molecular Formula | C29H37OP |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol |
| SMILES | CCCCCCCCC(O)C(C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H37OP/c1-3-4-5-6-7-17-24-29(30)25(2)31(26-18-11-8-12-19-26,27-20-13-9-14-21-27)28-22-15-10-16-23-28/h8-16,18-23,29-30H,3-7,17,24H2,1-2H3 |
| InChIKey | MYKNEYHBWJXMQO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol?
The IUPAC name of 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol (CID 11743555) is 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol.
What is the SMILES notation for 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol?
The canonical SMILES for 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol is CCCCCCCCC(O)C(C)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol?
The InChIKey is MYKNEYHBWJXMQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H37OP/c1-3-4-5-6-7-17-24-29(30)25(2)31(26-18-11-8-12-19-26,27-20-13-9-14-21-27)28-22-15-10-16-23-28/h8-16,18-23,29-30H,3-7,17,24H2,1-2H3.
What are the key properties of 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol?
2-(triphenyl-λ5-phosphanylidene)undecan-3-ol has a molecular weight of 432.59 g/mol, XLogP of 6.28, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triphenyl-λ5-phosphanylidene)undecan-3-ol is sourced from PubChem (CID 11743555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).