About diphenylphosphinate;trihexyl(methyl)phosphanium
diphenylphosphinate;trihexyl(methyl)phosphanium (PubChem CID 18979396) has the molecular formula C31H52O2P2
and a molecular weight of 518.70 g/mol. Its IUPAC name is diphenylphosphinate;trihexyl(methyl)phosphanium.
Molecular Properties
| Compound Name | diphenylphosphinate;trihexyl(methyl)phosphanium |
| PubChem CID | 18979396 |
| Molecular Formula | C31H52O2P2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | diphenylphosphinate;trihexyl(methyl)phosphanium |
| SMILES | CCCCCC[P+](C)(CCCCCC)CCCCCC.O=P([O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H42P.C12H11O2P/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h5-19H2,1-4H3;1-10H,(H,13,14)/q+1;/p-1 |
| InChIKey | LZXUSTXNGCYYBQ-UHFFFAOYSA-M |
| XLogP | 8.65 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphinate;trihexyl(methyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphinate;trihexyl(methyl)phosphanium?
The IUPAC name of diphenylphosphinate;trihexyl(methyl)phosphanium (CID 18979396) is diphenylphosphinate;trihexyl(methyl)phosphanium.
What is the SMILES notation for diphenylphosphinate;trihexyl(methyl)phosphanium?
The canonical SMILES for diphenylphosphinate;trihexyl(methyl)phosphanium is CCCCCC[P+](C)(CCCCCC)CCCCCC.O=P([O-])(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphinate;trihexyl(methyl)phosphanium?
The InChIKey is LZXUSTXNGCYYBQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H42P.C12H11O2P/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h5-19H2,1-4H3;1-10H,(H,13,14)/q+1;/p-1.
What are the key properties of diphenylphosphinate;trihexyl(methyl)phosphanium?
diphenylphosphinate;trihexyl(methyl)phosphanium has a molecular weight of 518.70 g/mol, XLogP of 8.65, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphinate;trihexyl(methyl)phosphanium is sourced from PubChem (CID 18979396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).