About lithium diphenylphosphinate
lithium diphenylphosphinate (PubChem CID 23680317) has the molecular formula C12H10LiO2P
and a molecular weight of 224.13 g/mol. Its IUPAC name is lithium diphenylphosphinate.
Molecular Properties
| Compound Name | lithium diphenylphosphinate |
| PubChem CID | 23680317 |
| Molecular Formula | C12H10LiO2P |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | lithium diphenylphosphinate |
| SMILES | O=P([O-])(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C12H11O2P.Li/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,(H,13,14);/q;+1/p-1 |
| InChIKey | NQLHDVQSVZURSH-UHFFFAOYSA-M |
| XLogP | -1.72 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium diphenylphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium diphenylphosphinate?
The IUPAC name of lithium diphenylphosphinate (CID 23680317) is lithium diphenylphosphinate.
What is the SMILES notation for lithium diphenylphosphinate?
The canonical SMILES for lithium diphenylphosphinate is O=P([O-])(c1ccccc1)c1ccccc1.[Li+].
What is the InChIKey of lithium diphenylphosphinate?
The InChIKey is NQLHDVQSVZURSH-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H11O2P.Li/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,(H,13,14);/q;+1/p-1.
What are the key properties of lithium diphenylphosphinate?
lithium diphenylphosphinate has a molecular weight of 224.13 g/mol, XLogP of -1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium diphenylphosphinate is sourced from PubChem (CID 23680317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).