About dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+)
dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) (PubChem CID 175055456) has the molecular formula C6H5FeNiO3P
and a molecular weight of 270.62 g/mol. Its IUPAC name is dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+).
Molecular Properties
| Compound Name | dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) |
| PubChem CID | 175055456 |
| Molecular Formula | C6H5FeNiO3P |
| Molecular Weight | 270.62 g/mol |
| Exact Mass | 269.87 |
| IUPAC Name | dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) |
| SMILES | O=P([O-])([O-])c1ccccc1.[Fe].[Ni+2] |
| InChI | InChI=1S/C6H7O3P.Fe.Ni/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H2,7,8,9);;/q;;+2/p-2 |
| InChIKey | NKRHMEUHRJCLJI-UHFFFAOYSA-L |
| XLogP | -0.78 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.62 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+)?
The IUPAC name of dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) (CID 175055456) is dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+).
What is the SMILES notation for dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+)?
The canonical SMILES for dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) is O=P([O-])([O-])c1ccccc1.[Fe].[Ni+2].
What is the InChIKey of dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+)?
The InChIKey is NKRHMEUHRJCLJI-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H7O3P.Fe.Ni/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H,(H2,7,8,9);;/q;;+2/p-2.
What are the key properties of dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+)?
dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) has a molecular weight of 270.62 g/mol, XLogP of -0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido-oxo-phenyl-λ5-phosphane;iron;nickel(2+) is sourced from PubChem (CID 175055456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).