About dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium)
dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) (PubChem CID 66628068) has the molecular formula C38H77N2O3P
and a molecular weight of 641.02 g/mol. Its IUPAC name is dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium).
Molecular Properties
| Compound Name | dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) |
| PubChem CID | 66628068 |
| Molecular Formula | C38H77N2O3P |
| Molecular Weight | 641.02 g/mol |
| Exact Mass | 640.57 |
| IUPAC Name | dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=P([O-])([O-])c1ccccc1 |
| InChI | InChI=1S/2C16H36N.C6H7O3P/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-10(8,9)6-4-2-1-3-5-6/h2*5-16H2,1-4H3;1-5H,(H2,7,8,9)/q2*+1;/p-2 |
| InChIKey | WZCDOURFYAECOS-UHFFFAOYSA-L |
| XLogP | 9.23 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.02 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium)?
The IUPAC name of dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) (CID 66628068) is dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium).
What is the SMILES notation for dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium)?
The canonical SMILES for dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=P([O-])([O-])c1ccccc1.
What is the InChIKey of dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium)?
The InChIKey is WZCDOURFYAECOS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H36N.C6H7O3P/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-10(8,9)6-4-2-1-3-5-6/h2*5-16H2,1-4H3;1-5H,(H2,7,8,9)/q2*+1;/p-2.
What are the key properties of dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium)?
dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) has a molecular weight of 641.02 g/mol, XLogP of 9.23, 25 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido-oxo-phenyl-λ5-phosphane;bis(tetrabutylazanium) is sourced from PubChem (CID 66628068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).