About benzenethiolate;tetrabutylazanium
benzenethiolate;tetrabutylazanium (PubChem CID 11772529) has the molecular formula C22H41NS
and a molecular weight of 351.64 g/mol. Its IUPAC name is benzenethiolate;tetrabutylazanium.
Molecular Properties
| Compound Name | benzenethiolate;tetrabutylazanium |
| PubChem CID | 11772529 |
| Molecular Formula | C22H41NS |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | benzenethiolate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[S-]c1ccccc1 |
| InChI | InChI=1S/C16H36N.C6H6S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-6-4-2-1-3-5-6/h5-16H2,1-4H3;1-5,7H/q+1;/p-1 |
| InChIKey | DCYKVBXIMAFNDD-UHFFFAOYSA-M |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze benzenethiolate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiolate;tetrabutylazanium?
The IUPAC name of benzenethiolate;tetrabutylazanium (CID 11772529) is benzenethiolate;tetrabutylazanium.
What is the SMILES notation for benzenethiolate;tetrabutylazanium?
The canonical SMILES for benzenethiolate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.[S-]c1ccccc1.
What is the InChIKey of benzenethiolate;tetrabutylazanium?
The InChIKey is DCYKVBXIMAFNDD-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C6H6S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-6-4-2-1-3-5-6/h5-16H2,1-4H3;1-5,7H/q+1;/p-1.
What are the key properties of benzenethiolate;tetrabutylazanium?
benzenethiolate;tetrabutylazanium has a molecular weight of 351.64 g/mol, XLogP of 6.60, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiolate;tetrabutylazanium is sourced from PubChem (CID 11772529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).