About difluoro(phenyl)borane;tetrabutylazanium;fluoride
difluoro(phenyl)borane;tetrabutylazanium;fluoride (PubChem CID 166604409) has the molecular formula C22H41BF3N
and a molecular weight of 387.38 g/mol. Its IUPAC name is difluoro(phenyl)borane;tetrabutylazanium;fluoride.
Molecular Properties
| Compound Name | difluoro(phenyl)borane;tetrabutylazanium;fluoride |
| PubChem CID | 166604409 |
| Molecular Formula | C22H41BF3N |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.33 |
| IUPAC Name | difluoro(phenyl)borane;tetrabutylazanium;fluoride |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.FB(F)c1ccccc1.[F-] |
| InChI | InChI=1S/C16H36N.C6H5BF2.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)6-4-2-1-3-5-6;/h5-16H2,1-4H3;1-5H;1H/q+1;;/p-1 |
| InChIKey | IWTNFEUYZVMFQJ-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze difluoro(phenyl)borane;tetrabutylazanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoro(phenyl)borane;tetrabutylazanium;fluoride?
The IUPAC name of difluoro(phenyl)borane;tetrabutylazanium;fluoride (CID 166604409) is difluoro(phenyl)borane;tetrabutylazanium;fluoride.
What is the SMILES notation for difluoro(phenyl)borane;tetrabutylazanium;fluoride?
The canonical SMILES for difluoro(phenyl)borane;tetrabutylazanium;fluoride is CCCC[N+](CCCC)(CCCC)CCCC.FB(F)c1ccccc1.[F-].
What is the InChIKey of difluoro(phenyl)borane;tetrabutylazanium;fluoride?
The InChIKey is IWTNFEUYZVMFQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C6H5BF2.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)6-4-2-1-3-5-6;/h5-16H2,1-4H3;1-5H;1H/q+1;;/p-1.
What are the key properties of difluoro(phenyl)borane;tetrabutylazanium;fluoride?
difluoro(phenyl)borane;tetrabutylazanium;fluoride has a molecular weight of 387.38 g/mol, XLogP of 3.33, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(phenyl)borane;tetrabutylazanium;fluoride is sourced from PubChem (CID 166604409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).