About phosphane;tetrabutylazanium;fluoride
phosphane;tetrabutylazanium;fluoride (PubChem CID 174703499) has the molecular formula C16H39FNP
and a molecular weight of 295.47 g/mol. Its IUPAC name is phosphane;tetrabutylazanium;fluoride.
Molecular Properties
| Compound Name | phosphane;tetrabutylazanium;fluoride |
| PubChem CID | 174703499 |
| Molecular Formula | C16H39FNP |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.28 |
| IUPAC Name | phosphane;tetrabutylazanium;fluoride |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.P.[F-] |
| InChI | InChI=1S/C16H36N.FH.H3P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;1H;1H3/q+1;;/p-1 |
| InChIKey | BDDJDCGDQIVTLB-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze phosphane;tetrabutylazanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;tetrabutylazanium;fluoride?
The IUPAC name of phosphane;tetrabutylazanium;fluoride (CID 174703499) is phosphane;tetrabutylazanium;fluoride.
What is the SMILES notation for phosphane;tetrabutylazanium;fluoride?
The canonical SMILES for phosphane;tetrabutylazanium;fluoride is CCCC[N+](CCCC)(CCCC)CCCC.P.[F-].
What is the InChIKey of phosphane;tetrabutylazanium;fluoride?
The InChIKey is BDDJDCGDQIVTLB-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.FH.H3P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;1H;1H3/q+1;;/p-1.
What are the key properties of phosphane;tetrabutylazanium;fluoride?
phosphane;tetrabutylazanium;fluoride has a molecular weight of 295.47 g/mol, XLogP of 2.07, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;tetrabutylazanium;fluoride is sourced from PubChem (CID 174703499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).