About tetrabutylazanium hydroxide
tetrabutylazanium hydroxide (PubChem CID 2723671) has the molecular formula C16H37NO
and a molecular weight of 259.48 g/mol. Its IUPAC name is tetrabutylazanium hydroxide.
Molecular Properties
| Compound Name | tetrabutylazanium hydroxide |
| PubChem CID | 2723671 |
| Molecular Formula | C16H37NO |
| Molecular Weight | 259.48 g/mol |
| Exact Mass | 259.29 |
| IUPAC Name | tetrabutylazanium hydroxide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[OH-] |
| InChI | InChI=1S/C16H36N.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| XLogP | 4.83 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium hydroxide?
The IUPAC name of tetrabutylazanium hydroxide (CID 2723671) is tetrabutylazanium hydroxide.
What is the SMILES notation for tetrabutylazanium hydroxide?
The canonical SMILES for tetrabutylazanium hydroxide is CCCC[N+](CCCC)(CCCC)CCCC.[OH-].
What is the InChIKey of tetrabutylazanium hydroxide?
The InChIKey is VDZOOKBUILJEDG-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H2/q+1;/p-1.
What are the key properties of tetrabutylazanium hydroxide?
tetrabutylazanium hydroxide has a molecular weight of 259.48 g/mol, XLogP of 4.83, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium hydroxide is sourced from PubChem (CID 2723671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).