About 2-sulfanylbenzoic acid;tetrabutylazanium
2-sulfanylbenzoic acid;tetrabutylazanium (PubChem CID 174440001) has the molecular formula C23H42NO2S+
and a molecular weight of 396.66 g/mol. Its IUPAC name is 2-sulfanylbenzoic acid;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-sulfanylbenzoic acid;tetrabutylazanium |
| PubChem CID | 174440001 |
| Molecular Formula | C23H42NO2S+ |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 2-sulfanylbenzoic acid;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)c1ccccc1S |
| InChI | InChI=1S/C16H36N.C7H6O2S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)5-3-1-2-4-6(5)10/h5-16H2,1-4H3;1-4,10H,(H,8,9)/q+1; |
| InChIKey | TUNXXCRPWRATMX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylbenzoic acid;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylbenzoic acid;tetrabutylazanium?
The IUPAC name of 2-sulfanylbenzoic acid;tetrabutylazanium (CID 174440001) is 2-sulfanylbenzoic acid;tetrabutylazanium.
What is the SMILES notation for 2-sulfanylbenzoic acid;tetrabutylazanium?
The canonical SMILES for 2-sulfanylbenzoic acid;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=C(O)c1ccccc1S.
What is the InChIKey of 2-sulfanylbenzoic acid;tetrabutylazanium?
The InChIKey is TUNXXCRPWRATMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C7H6O2S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)5-3-1-2-4-6(5)10/h5-16H2,1-4H3;1-4,10H,(H,8,9)/q+1;.
What are the key properties of 2-sulfanylbenzoic acid;tetrabutylazanium?
2-sulfanylbenzoic acid;tetrabutylazanium has a molecular weight of 396.66 g/mol, XLogP of 6.68, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylbenzoic acid;tetrabutylazanium is sourced from PubChem (CID 174440001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).