About 2-iodobenzoate;tetrabutylazanium
2-iodobenzoate;tetrabutylazanium (PubChem CID 156506348) has the molecular formula C23H40INO2
and a molecular weight of 489.48 g/mol. Its IUPAC name is 2-iodobenzoate;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-iodobenzoate;tetrabutylazanium |
| PubChem CID | 156506348 |
| Molecular Formula | C23H40INO2 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-iodobenzoate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])c1ccccc1I |
| InChI | InChI=1S/C16H36N.C7H5IO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-6-4-2-1-3-5(6)7(9)10/h5-16H2,1-4H3;1-4H,(H,9,10)/q+1;/p-1 |
| InChIKey | FQTYVZYOVDFZAI-UHFFFAOYSA-M |
| XLogP | 5.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-iodobenzoate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodobenzoate;tetrabutylazanium?
The IUPAC name of 2-iodobenzoate;tetrabutylazanium (CID 156506348) is 2-iodobenzoate;tetrabutylazanium.
What is the SMILES notation for 2-iodobenzoate;tetrabutylazanium?
The canonical SMILES for 2-iodobenzoate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])c1ccccc1I.
What is the InChIKey of 2-iodobenzoate;tetrabutylazanium?
The InChIKey is FQTYVZYOVDFZAI-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C7H5IO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-6-4-2-1-3-5(6)7(9)10/h5-16H2,1-4H3;1-4H,(H,9,10)/q+1;/p-1.
What are the key properties of 2-iodobenzoate;tetrabutylazanium?
2-iodobenzoate;tetrabutylazanium has a molecular weight of 489.48 g/mol, XLogP of 5.66, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodobenzoate;tetrabutylazanium is sourced from PubChem (CID 156506348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).