About 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium
2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium (PubChem CID 159793510) has the molecular formula C34H53NO5S
and a molecular weight of 587.87 g/mol. Its IUPAC name is 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium.
Molecular Properties
| Compound Name | 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium |
| PubChem CID | 159793510 |
| Molecular Formula | C34H53NO5S |
| Molecular Weight | 587.87 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.O=C([O-])c1ccccc1S(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C20H44N.C14H10O5S/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;15-13(16)9-5-1-3-7-11(9)20(19)12-8-4-2-6-10(12)14(17)18/h5-20H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1;/p-1 |
| InChIKey | NIWHCLZEJDQASI-UHFFFAOYSA-M |
| XLogP | 7.48 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.87 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium?
The IUPAC name of 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium (CID 159793510) is 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium.
What is the SMILES notation for 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium?
The canonical SMILES for 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium is CCCCC[N+](CCCCC)(CCCCC)CCCCC.O=C([O-])c1ccccc1S(=O)c1ccccc1C(=O)O.
What is the InChIKey of 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium?
The InChIKey is NIWHCLZEJDQASI-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H44N.C14H10O5S/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;15-13(16)9-5-1-3-7-11(9)20(19)12-8-4-2-6-10(12)14(17)18/h5-20H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1;/p-1.
What are the key properties of 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium?
2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium has a molecular weight of 587.87 g/mol, XLogP of 7.48, 20 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapentylazanium is sourced from PubChem (CID 159793510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).