C26H37NO5S — CID 18948207
2-(2-carboxyphenyl)sulfinylbenzoate;tetrapropylazanium (PubChem CID 18948207) has the molecular formula C26H37NO5S and a molecular weight of 475.65 g/mol. Its IUPAC name is 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapropylazanium.
| Compound Name | 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapropylazanium |
|---|---|
| PubChem CID | 18948207 |
| Molecular Formula | C26H37NO5S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 2-(2-carboxyphenyl)sulfinylbenzoate;tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.O=C([O-])c1ccccc1S(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H10O5S.C12H28N/c15-13(16)9-5-1-3-7-11(9)20(19)12-8-4-2-6-10(12)14(17)18;1-5-9-13(10-6-2,11-7-3)12-8-4/h1-8H,(H,15,16)(H,17,18);5-12H2,1-4H3/q;+1/p-1 |
| InChIKey | BTVLRZHZEBGJFY-UHFFFAOYSA-M |
| XLogP | 4.36 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|