About 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium
2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium (PubChem CID 67856140) has the molecular formula C46H78NO5S+
and a molecular weight of 757.20 g/mol. Its IUPAC name is 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium.
Molecular Properties
| Compound Name | 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium |
| PubChem CID | 67856140 |
| Molecular Formula | C46H78NO5S+ |
| Molecular Weight | 757.20 g/mol |
| Exact Mass | 756.56 |
| IUPAC Name | 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.O=C(O)c1ccccc1S(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C32H68N.C14H10O5S/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;15-13(16)9-5-1-3-7-11(9)20(19)12-8-4-2-6-10(12)14(17)18/h5-32H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1; |
| InChIKey | NBOWECSWRJLYDR-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 757.20 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium?
The IUPAC name of 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium (CID 67856140) is 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium.
What is the SMILES notation for 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium?
The canonical SMILES for 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium is CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.O=C(O)c1ccccc1S(=O)c1ccccc1C(=O)O.
What is the InChIKey of 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium?
The InChIKey is NBOWECSWRJLYDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H68N.C14H10O5S/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;15-13(16)9-5-1-3-7-11(9)20(19)12-8-4-2-6-10(12)14(17)18/h5-32H2,1-4H3;1-8H,(H,15,16)(H,17,18)/q+1;.
What are the key properties of 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium?
2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium has a molecular weight of 757.20 g/mol, XLogP of 13.49, 32 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-carboxyphenyl)sulfinylbenzoic acid;tetraoctylazanium is sourced from PubChem (CID 67856140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).