C30H44NO4S2+ — CID 67782643
dibutyl-bis[4-(2-carboxyphenyl)sulfanylbutyl]azanium (PubChem CID 67782643) has the molecular formula C30H44NO4S2+ and a molecular weight of 546.82 g/mol. Its IUPAC name is dibutyl-bis[4-(2-carboxyphenyl)sulfanylbutyl]azanium.
| Compound Name | dibutyl-bis[4-(2-carboxyphenyl)sulfanylbutyl]azanium |
|---|---|
| PubChem CID | 67782643 |
| Molecular Formula | C30H44NO4S2+ |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | dibutyl-bis[4-(2-carboxyphenyl)sulfanylbutyl]azanium |
| SMILES | CCCC[N+](CCCC)(CCCCSc1ccccc1C(=O)O)CCCCSc1ccccc1C(=O)O |
| InChI | InChI=1S/C30H43NO4S2/c1-3-5-19-31(20-6-4-2,21-11-13-23-36-27-17-9-7-15-25(27)29(32)33)22-12-14-24-37-28-18-10-8-16-26(28)30(34)35/h7-10,15-18H,3-6,11-14,19-24H2,1-2H3,(H-,32,33,34,35)/p+1 |
| InChIKey | OFHZWOUQGDFNIS-UHFFFAOYSA-O |
| XLogP | 7.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|