C26H34N2O3S — CID 143267998
2-[5-[1,3-benzoxazol-2-yl(heptyl)amino]pentylsulfanyl]benzoic acid (PubChem CID 143267998) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 2-[5-[1,3-benzoxazol-2-yl(heptyl)amino]pentylsulfanyl]benzoic acid.
| Compound Name | 2-[5-[1,3-benzoxazol-2-yl(heptyl)amino]pentylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 143267998 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[5-[1,3-benzoxazol-2-yl(heptyl)amino]pentylsulfanyl]benzoic acid |
| SMILES | CCCCCCCN(CCCCCSc1ccccc1C(=O)O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C26H34N2O3S/c1-2-3-4-5-11-18-28(26-27-22-15-8-9-16-23(22)31-26)19-12-6-13-20-32-24-17-10-7-14-21(24)25(29)30/h7-10,14-17H,2-6,11-13,18-20H2,1H3,(H,29,30) |
| InChIKey | XSFREEJSFKJWGY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|