C27H36N2O4 — CID 18766460
2-[3-[3-[1,3-benzoxazol-2-yl(heptyl)amino]propyl]phenoxy]-2-methylpropanoic acid (PubChem CID 18766460) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[3-[3-[1,3-benzoxazol-2-yl(heptyl)amino]propyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[3-[1,3-benzoxazol-2-yl(heptyl)amino]propyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 18766460 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-[3-[3-[1,3-benzoxazol-2-yl(heptyl)amino]propyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCN(CCCc1cccc(OC(C)(C)C(=O)O)c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C27H36N2O4/c1-4-5-6-7-10-18-29(26-28-23-16-8-9-17-24(23)32-26)19-12-14-21-13-11-15-22(20-21)33-27(2,3)25(30)31/h8-9,11,13,15-17,20H,4-7,10,12,14,18-19H2,1-3H3,(H,30,31) |
| InChIKey | FDLVDJUXYHDABK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|