C23H28N2O4 — CID 58678518
3-[4-[1,3-benzoxazol-2-yl(pentyl)amino]butoxy]benzoic acid (PubChem CID 58678518) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[4-[1,3-benzoxazol-2-yl(pentyl)amino]butoxy]benzoic acid.
| Compound Name | 3-[4-[1,3-benzoxazol-2-yl(pentyl)amino]butoxy]benzoic acid |
|---|---|
| PubChem CID | 58678518 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-[4-[1,3-benzoxazol-2-yl(pentyl)amino]butoxy]benzoic acid |
| SMILES | CCCCCN(CCCCOc1cccc(C(=O)O)c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-3-6-14-25(23-24-20-12-4-5-13-21(20)29-23)15-7-8-16-28-19-11-9-10-18(17-19)22(26)27/h4-5,9-13,17H,2-3,6-8,14-16H2,1H3,(H,26,27) |
| InChIKey | VJNSUYQFRYOWRS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|