C20H22N2O4 — CID 58678491
2-[3-[1,3-benzoxazol-2-yl(propyl)amino]propoxy]benzoic acid (PubChem CID 58678491) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[3-[1,3-benzoxazol-2-yl(propyl)amino]propoxy]benzoic acid.
| Compound Name | 2-[3-[1,3-benzoxazol-2-yl(propyl)amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 58678491 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[3-[1,3-benzoxazol-2-yl(propyl)amino]propoxy]benzoic acid |
| SMILES | CCCN(CCCOc1ccccc1C(=O)O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C20H22N2O4/c1-2-12-22(20-21-16-9-4-6-11-18(16)26-20)13-7-14-25-17-10-5-3-8-15(17)19(23)24/h3-6,8-11H,2,7,12-14H2,1H3,(H,23,24) |
| InChIKey | GGRTXXQZZMGOQM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|