C24H21ClN2O4 — CID 58678501
4-[3-[1,3-benzoxazol-2-yl-[(4-chlorophenyl)methyl]amino]propoxy]benzoic acid (PubChem CID 58678501) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is 4-[3-[1,3-benzoxazol-2-yl-[(4-chlorophenyl)methyl]amino]propoxy]benzoic acid.
| Compound Name | 4-[3-[1,3-benzoxazol-2-yl-[(4-chlorophenyl)methyl]amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 58678501 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-[3-[1,3-benzoxazol-2-yl-[(4-chlorophenyl)methyl]amino]propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN(Cc2ccc(Cl)cc2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C24H21ClN2O4/c25-19-10-6-17(7-11-19)16-27(24-26-21-4-1-2-5-22(21)31-24)14-3-15-30-20-12-8-18(9-13-20)23(28)29/h1-2,4-13H,3,14-16H2,(H,28,29) |
| InChIKey | ACRSUKHOHQRANR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|