C29H32N2O6 — CID 154974932
(2S)-2-[[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]methyl]butanoic acid (PubChem CID 154974932) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is (2S)-2-[[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]methyl]butanoic acid.
| Compound Name | (2S)-2-[[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]methyl]butanoic acid |
|---|---|
| PubChem CID | 154974932 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | (2S)-2-[[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]methyl]butanoic acid |
| SMILES | CC[C@@H](COc1cccc(CN(CCCOc2ccc(OC)cc2)c2nc3ccccc3o2)c1)C(=O)O |
| InChI | InChI=1S/C29H32N2O6/c1-3-22(28(32)33)20-36-25-9-6-8-21(18-25)19-31(29-30-26-10-4-5-11-27(26)37-29)16-7-17-35-24-14-12-23(34-2)13-15-24/h4-6,8-15,18,22H,3,7,16-17,19-20H2,1-2H3,(H,32,33)/t22-/m0/s1 |
| InChIKey | POYPMTSKXAWDNZ-QFIPXVFZSA-N |
| XLogP | 5.80 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|