C28H29N3O6 — CID 143013998
2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]-N-oxobutanamide (PubChem CID 143013998) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is 2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]-N-oxobutanamide.
| Compound Name | 2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]-N-oxobutanamide |
|---|---|
| PubChem CID | 143013998 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]-N-oxobutanamide |
| SMILES | CCC(Oc1cccc(CN(CCCOc2ccc(OC)cc2)c2nc3ccccc3o2)c1)C(=O)N=O |
| InChI | InChI=1S/C28H29N3O6/c1-3-25(27(32)30-33)36-23-9-6-8-20(18-23)19-31(28-29-24-10-4-5-11-26(24)37-28)16-7-17-35-22-14-12-21(34-2)13-15-22/h4-6,8-15,18,25H,3,7,16-17,19H2,1-2H3 |
| InChIKey | YESJUJNHZPCDQX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 103.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|