C17H15N2O4- — CID 143267996
1,3-benzoxazol-2-yl-[3-(3-carboxyphenoxy)propyl]azanide (PubChem CID 143267996) has the molecular formula C17H15N2O4- and a molecular weight of 311.32 g/mol. Its IUPAC name is 1,3-benzoxazol-2-yl-[3-(3-carboxyphenoxy)propyl]azanide.
| Compound Name | 1,3-benzoxazol-2-yl-[3-(3-carboxyphenoxy)propyl]azanide |
|---|---|
| PubChem CID | 143267996 |
| Molecular Formula | C17H15N2O4- |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1,3-benzoxazol-2-yl-[3-(3-carboxyphenoxy)propyl]azanide |
| SMILES | O=C(O)c1cccc(OCCC[N-]c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C17H16N2O4/c20-16(21)12-5-3-6-13(11-12)22-10-4-9-18-17-19-14-7-1-2-8-15(14)23-17/h1-3,5-8,11H,4,9-10H2,(H2,18,19,20,21)/p-1 |
| InChIKey | JEIUCELPVUOQQN-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|