C31H35N2O4- — CID 91928423
(2S)-2-[4-[2-[1,3-benzoxazol-2-yl(heptyl)amino]ethyl]phenoxy]-3-phenylpropanoate (PubChem CID 91928423) has the molecular formula C31H35N2O4- and a molecular weight of 499.63 g/mol. Its IUPAC name is (2S)-2-[4-[2-[1,3-benzoxazol-2-yl(heptyl)amino]ethyl]phenoxy]-3-phenylpropanoate.
| Compound Name | (2S)-2-[4-[2-[1,3-benzoxazol-2-yl(heptyl)amino]ethyl]phenoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 91928423 |
| Molecular Formula | C31H35N2O4- |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (2S)-2-[4-[2-[1,3-benzoxazol-2-yl(heptyl)amino]ethyl]phenoxy]-3-phenylpropanoate |
| SMILES | CCCCCCCN(CCc1ccc(O[C@@H](Cc2ccccc2)C(=O)[O-])cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C31H36N2O4/c1-2-3-4-5-11-21-33(31-32-27-14-9-10-15-28(27)37-31)22-20-24-16-18-26(19-17-24)36-29(30(34)35)23-25-12-7-6-8-13-25/h6-10,12-19,29H,2-5,11,20-23H2,1H3,(H,34,35)/p-1/t29-/m0/s1 |
| InChIKey | CSFPOCDMBLMFTM-LJAQVGFWSA-M |
| XLogP | 5.59 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|