C33H36NNaO3 — CID 86759771
sodium (2R)-2-[4-[5-methyl-1-[2-(4-pentylphenyl)ethyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate (PubChem CID 86759771) has the molecular formula C33H36NNaO3 and a molecular weight of 517.65 g/mol. Its IUPAC name is sodium (2R)-2-[4-[5-methyl-1-[2-(4-pentylphenyl)ethyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate.
| Compound Name | sodium (2R)-2-[4-[5-methyl-1-[2-(4-pentylphenyl)ethyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86759771 |
| Molecular Formula | C33H36NNaO3 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | sodium (2R)-2-[4-[5-methyl-1-[2-(4-pentylphenyl)ethyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate |
| SMILES | CCCCCc1ccc(CCn2c(C)ccc2-c2ccc(O[C@H](Cc3ccccc3)C(=O)[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C33H37NO3.Na/c1-3-4-6-9-26-13-15-27(16-14-26)22-23-34-25(2)12-21-31(34)29-17-19-30(20-18-29)37-32(33(35)36)24-28-10-7-5-8-11-28;/h5,7-8,10-21,32H,3-4,6,9,22-24H2,1-2H3,(H,35,36);/q;+1/p-1/t32-;/m1./s1 |
| InChIKey | HCFGSNVLOCGWIX-RYWNGCACSA-M |
| XLogP | 3.18 |
| TPSA | 54.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|