C38H47NO3 — CID 90990759
ethyl (2R)-2-[4-[1-(4-decylphenyl)-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate (PubChem CID 90990759) has the molecular formula C38H47NO3 and a molecular weight of 565.80 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[1-(4-decylphenyl)-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[4-[1-(4-decylphenyl)-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 90990759 |
| Molecular Formula | C38H47NO3 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | ethyl (2R)-2-[4-[1-(4-decylphenyl)-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate |
| SMILES | CCCCCCCCCCc1ccc(-n2c(C)ccc2-c2ccc(O[C@H](Cc3ccccc3)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C38H47NO3/c1-4-6-7-8-9-10-11-13-16-31-20-24-34(25-21-31)39-30(3)19-28-36(39)33-22-26-35(27-23-33)42-37(38(40)41-5-2)29-32-17-14-12-15-18-32/h12,14-15,17-28,37H,4-11,13,16,29H2,1-3H3/t37-/m1/s1 |
| InChIKey | AOQNEBAANSVELD-DIPNUNPCSA-N |
| XLogP | 9.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|