C30H30BrNO3 — CID 86588891
ethyl (2R)-2-[4-[1-[2-(4-bromophenyl)ethyl]-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate (PubChem CID 86588891) has the molecular formula C30H30BrNO3 and a molecular weight of 532.48 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[1-[2-(4-bromophenyl)ethyl]-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[4-[1-[2-(4-bromophenyl)ethyl]-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86588891 |
| Molecular Formula | C30H30BrNO3 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | ethyl (2R)-2-[4-[1-[2-(4-bromophenyl)ethyl]-5-methylpyrrol-2-yl]phenoxy]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccccc1)Oc1ccc(-c2ccc(C)n2CCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C30H30BrNO3/c1-3-34-30(33)29(21-24-7-5-4-6-8-24)35-27-16-12-25(13-17-27)28-18-9-22(2)32(28)20-19-23-10-14-26(31)15-11-23/h4-18,29H,3,19-21H2,1-2H3/t29-/m1/s1 |
| InChIKey | FYOFVMDJJTUYIF-GDLZYMKVSA-N |
| XLogP | 7.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|