C36H43NO3 — CID 86759769
ethyl (2R)-2-[4-[5-methyl-1-[3-(4-pentylphenyl)propyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate (PubChem CID 86759769) has the molecular formula C36H43NO3 and a molecular weight of 537.74 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[5-methyl-1-[3-(4-pentylphenyl)propyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[4-[5-methyl-1-[3-(4-pentylphenyl)propyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 86759769 |
| Molecular Formula | C36H43NO3 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | ethyl (2R)-2-[4-[5-methyl-1-[3-(4-pentylphenyl)propyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate |
| SMILES | CCCCCc1ccc(CCCn2c(C)ccc2-c2ccc(O[C@H](Cc3ccccc3)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C36H43NO3/c1-4-6-8-12-29-17-19-30(20-18-29)15-11-26-37-28(3)16-25-34(37)32-21-23-33(24-22-32)40-35(36(38)39-5-2)27-31-13-9-7-10-14-31/h7,9-10,13-14,16-25,35H,4-6,8,11-12,15,26-27H2,1-3H3/t35-/m1/s1 |
| InChIKey | VZZWBYSUBUCZSP-PGUFJCEWSA-N |
| XLogP | 8.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|