C38H45NO4 — CID 91012625
ethyl (2R)-2-[4-[5-methyl-1-[4-[(4-propylcyclohexyl)methoxy]phenyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate (PubChem CID 91012625) has the molecular formula C38H45NO4 and a molecular weight of 579.78 g/mol. Its IUPAC name is ethyl (2R)-2-[4-[5-methyl-1-[4-[(4-propylcyclohexyl)methoxy]phenyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[4-[5-methyl-1-[4-[(4-propylcyclohexyl)methoxy]phenyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 91012625 |
| Molecular Formula | C38H45NO4 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | ethyl (2R)-2-[4-[5-methyl-1-[4-[(4-propylcyclohexyl)methoxy]phenyl]pyrrol-2-yl]phenoxy]-3-phenylpropanoate |
| SMILES | CCCC1CCC(COc2ccc(-n3c(C)ccc3-c3ccc(O[C@H](Cc4ccccc4)C(=O)OCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C38H45NO4/c1-4-9-29-13-15-31(16-14-29)27-42-34-23-19-33(20-24-34)39-28(3)12-25-36(39)32-17-21-35(22-18-32)43-37(38(40)41-5-2)26-30-10-7-6-8-11-30/h6-8,10-12,17-25,29,31,37H,4-5,9,13-16,26-27H2,1-3H3/t29?,31?,37-/m1/s1 |
| InChIKey | BXTJOPBWZVTFFQ-VMBZIFTNSA-N |
| XLogP | 8.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|