C31H35NO3 — CID 158823697
benzyl 4-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]-3-methylbutanoate (PubChem CID 158823697) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is benzyl 4-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]-3-methylbutanoate.
| Compound Name | benzyl 4-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 158823697 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | benzyl 4-[4-[1-[4-(cyclopropylmethoxy)phenyl]azetidin-3-yl]phenyl]-3-methylbutanoate |
| SMILES | CC(CC(=O)OCc1ccccc1)Cc1ccc(C2CN(c3ccc(OCC4CC4)cc3)C2)cc1 |
| InChI | InChI=1S/C31H35NO3/c1-23(18-31(33)35-22-25-5-3-2-4-6-25)17-24-9-11-27(12-10-24)28-19-32(20-28)29-13-15-30(16-14-29)34-21-26-7-8-26/h2-6,9-16,23,26,28H,7-8,17-22H2,1H3 |
| InChIKey | IWEMCOOCYSQPBS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|