benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate

C27H28O3 — CID 18655707

IUPACbenzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate
SMILESO=C(OCc1ccccc1)C1CCC(c2ccc(OCc3ccccc3)cc2)CC1
InChIInChI=1S/C27H28O3/c28-27(30-20-22-9-5-2-6-10-22)25-13-11-23(12-14-25)24-15-17-26(18-16-24)29-19-21-7-3-1-4-8-21/h1-10,15-18,23,25H,11-14,19-20H2
InChIKeyAZNNDDOHBHMIFZ-UHFFFAOYSA-N
MW400.52 g/mol
LogP6.28
Rot. Bonds7

About benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate

benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate (PubChem CID 18655707) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate.

Molecular Properties

Compound Namebenzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate
PubChem CID18655707
Molecular FormulaC27H28O3
Molecular Weight400.52 g/mol
Exact Mass400.20
IUPAC Namebenzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate
SMILESO=C(OCc1ccccc1)C1CCC(c2ccc(OCc3ccccc3)cc2)CC1
InChIInChI=1S/C27H28O3/c28-27(30-20-22-9-5-2-6-10-22)25-13-11-23(12-14-25)24-15-17-26(18-16-24)29-19-21-7-3-1-4-8-21/h1-10,15-18,23,25H,11-14,19-20H2
InChIKeyAZNNDDOHBHMIFZ-UHFFFAOYSA-N
XLogP6.28
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500400.52
LogP ≤ 56.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate?
The IUPAC name of benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate (CID 18655707) is benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate?
The canonical SMILES for benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate is O=C(OCc1ccccc1)C1CCC(c2ccc(OCc3ccccc3)cc2)CC1.
What is the InChIKey of benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate?
The InChIKey is AZNNDDOHBHMIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28O3/c28-27(30-20-22-9-5-2-6-10-22)25-13-11-23(12-14-25)24-15-17-26(18-16-24)29-19-21-7-3-1-4-8-21/h1-10,15-18,23,25H,11-14,19-20H2.
What are the key properties of benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate?
benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate has a molecular weight of 400.52 g/mol, XLogP of 6.28, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(4-phenylmethoxyphenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 18655707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).