C29H32O4 — CID 21084282
2-(4-cyclohexylphenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 21084282) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is 2-(4-cyclohexylphenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | 2-(4-cyclohexylphenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 21084282 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2-(4-cyclohexylphenoxy)-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | CC(Cc1ccc(OCc2ccccc2)cc1)(Oc1ccc(C2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C29H32O4/c1-29(28(30)31,33-27-18-14-25(15-19-27)24-10-6-3-7-11-24)20-22-12-16-26(17-13-22)32-21-23-8-4-2-5-9-23/h2,4-5,8-9,12-19,24H,3,6-7,10-11,20-21H2,1H3,(H,30,31) |
| InChIKey | ZXKFNBKOIOIZHF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |