C24H30O4 — CID 69314782
ethyl 2-(4-cyclohexylphenoxy)-3-(4-hydroxyphenyl)-2-methylpropanoate (PubChem CID 69314782) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is ethyl 2-(4-cyclohexylphenoxy)-3-(4-hydroxyphenyl)-2-methylpropanoate.
| Compound Name | ethyl 2-(4-cyclohexylphenoxy)-3-(4-hydroxyphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 69314782 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | ethyl 2-(4-cyclohexylphenoxy)-3-(4-hydroxyphenyl)-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(O)cc1)Oc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30O4/c1-3-27-23(26)24(2,17-18-9-13-21(25)14-10-18)28-22-15-11-20(12-16-22)19-7-5-4-6-8-19/h9-16,19,25H,3-8,17H2,1-2H3 |
| InChIKey | OWQRUGUGNVFZQQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |