C22H28O4 — CID 10522251
ethyl 3-(4-methoxyphenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate (PubChem CID 10522251) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is ethyl 3-(4-methoxyphenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate.
| Compound Name | ethyl 3-(4-methoxyphenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate |
|---|---|
| PubChem CID | 10522251 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethyl 3-(4-methoxyphenyl)-2-methyl-2-(4-propan-2-ylphenoxy)propanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(OC)cc1)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H28O4/c1-6-25-21(23)22(4,15-17-7-11-19(24-5)12-8-17)26-20-13-9-18(10-14-20)16(2)3/h7-14,16H,6,15H2,1-5H3 |
| InChIKey | IASYJXVBBIAGCK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |