C27H28O4 — CID 10549831
ethyl 2-(4-benzoylphenoxy)-3-(4-ethylphenyl)-2-methylpropanoate (PubChem CID 10549831) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethyl 2-(4-benzoylphenoxy)-3-(4-ethylphenyl)-2-methylpropanoate.
| Compound Name | ethyl 2-(4-benzoylphenoxy)-3-(4-ethylphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 10549831 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethyl 2-(4-benzoylphenoxy)-3-(4-ethylphenyl)-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(CC)cc1)Oc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28O4/c1-4-20-11-13-21(14-12-20)19-27(3,26(29)30-5-2)31-24-17-15-23(16-18-24)25(28)22-9-7-6-8-10-22/h6-18H,4-5,19H2,1-3H3 |
| InChIKey | YGWZFIVYTCOCTM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |