C17H18O4 — CID 67301593
2-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 67301593) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 67301593 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | CC(O)(Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C17H18O4/c1-17(20,16(18)19)11-13-7-9-15(10-8-13)21-12-14-5-3-2-4-6-14/h2-10,20H,11-12H2,1H3,(H,18,19) |
| InChIKey | CHMMJQPYQFPWIF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |