C22H27NO4 — CID 87513613
[3,3-dimethyl-2-(oxiran-2-yl)-1-(4-phenylmethoxyphenyl)butan-2-yl] carbamate (PubChem CID 87513613) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [3,3-dimethyl-2-(oxiran-2-yl)-1-(4-phenylmethoxyphenyl)butan-2-yl] carbamate.
| Compound Name | [3,3-dimethyl-2-(oxiran-2-yl)-1-(4-phenylmethoxyphenyl)butan-2-yl] carbamate |
|---|---|
| PubChem CID | 87513613 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [3,3-dimethyl-2-(oxiran-2-yl)-1-(4-phenylmethoxyphenyl)butan-2-yl] carbamate |
| SMILES | CC(C)(C)C(Cc1ccc(OCc2ccccc2)cc1)(OC(N)=O)C1CO1 |
| InChI | InChI=1S/C22H27NO4/c1-21(2,3)22(19-15-26-19,27-20(23)24)13-16-9-11-18(12-10-16)25-14-17-7-5-4-6-8-17/h4-12,19H,13-15H2,1-3H3,(H2,23,24) |
| InChIKey | ZXJWCDZXDDJYBL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|