C24H27NO2 — CID 67673733
(1R)-1-amino-3-methyl-3-phenyl-4-(4-phenylmethoxyphenyl)butan-1-ol (PubChem CID 67673733) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (1R)-1-amino-3-methyl-3-phenyl-4-(4-phenylmethoxyphenyl)butan-1-ol.
| Compound Name | (1R)-1-amino-3-methyl-3-phenyl-4-(4-phenylmethoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 67673733 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (1R)-1-amino-3-methyl-3-phenyl-4-(4-phenylmethoxyphenyl)butan-1-ol |
| SMILES | CC(Cc1ccc(OCc2ccccc2)cc1)(C[C@H](N)O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO2/c1-24(17-23(25)26,21-10-6-3-7-11-21)16-19-12-14-22(15-13-19)27-18-20-8-4-2-5-9-20/h2-15,23,26H,16-18,25H2,1H3/t23-,24?/m1/s1 |
| InChIKey | KGJGYKLZLPKRQI-MIHMCVIASA-N |
| XLogP | 4.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|