C21H28N4O4 — CID 142389029
(3Z)-3-amino-3-(aminohydrazinylidene)-2-[(2-methylpropan-2-yl)oxy]-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid (PubChem CID 142389029) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is (3Z)-3-amino-3-(aminohydrazinylidene)-2-[(2-methylpropan-2-yl)oxy]-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid.
| Compound Name | (3Z)-3-amino-3-(aminohydrazinylidene)-2-[(2-methylpropan-2-yl)oxy]-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid |
|---|---|
| PubChem CID | 142389029 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (3Z)-3-amino-3-(aminohydrazinylidene)-2-[(2-methylpropan-2-yl)oxy]-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid |
| SMILES | CC(C)(C)OC(Cc1ccc(OCc2ccccc2)cc1)(C(=O)O)/C(N)=N/NN |
| InChI | InChI=1S/C21H28N4O4/c1-20(2,3)29-21(19(26)27,18(22)24-25-23)13-15-9-11-17(12-10-15)28-14-16-7-5-4-6-8-16/h4-12,25H,13-14,23H2,1-3H3,(H2,22,24)(H,26,27) |
| InChIKey | HQXWUXXXDBYSHB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|