C25H24O6 — CID 141009558
3-ethoxy-3-oxo-2-phenoxy-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid (PubChem CID 141009558) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is 3-ethoxy-3-oxo-2-phenoxy-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid.
| Compound Name | 3-ethoxy-3-oxo-2-phenoxy-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid |
|---|---|
| PubChem CID | 141009558 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-ethoxy-3-oxo-2-phenoxy-2-[(4-phenylmethoxyphenyl)methyl]propanoic acid |
| SMILES | CCOC(=O)C(Cc1ccc(OCc2ccccc2)cc1)(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H24O6/c1-2-29-24(28)25(23(26)27,31-22-11-7-4-8-12-22)17-19-13-15-21(16-14-19)30-18-20-9-5-3-6-10-20/h3-16H,2,17-18H2,1H3,(H,26,27) |
| InChIKey | WQNREVYEYYMZOQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|