C22H26O5 — CID 131723198
4-O-tert-butyl 1-O-methyl 2-(4-phenylmethoxyphenyl)butanedioate (PubChem CID 131723198) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-(4-phenylmethoxyphenyl)butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-(4-phenylmethoxyphenyl)butanedioate |
|---|---|
| PubChem CID | 131723198 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-(4-phenylmethoxyphenyl)butanedioate |
| SMILES | COC(=O)C(CC(=O)OC(C)(C)C)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26O5/c1-22(2,3)27-20(23)14-19(21(24)25-4)17-10-12-18(13-11-17)26-15-16-8-6-5-7-9-16/h5-13,19H,14-15H2,1-4H3 |
| InChIKey | BABHBXHYQSLFLI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |