C19H24N2O3 — CID 78058335
tert-butyl 3-amino-3-(5-phenylmethoxy-3-pyridinyl)propanoate (PubChem CID 78058335) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl 3-amino-3-(5-phenylmethoxy-3-pyridinyl)propanoate.
| Compound Name | tert-butyl 3-amino-3-(5-phenylmethoxy-3-pyridinyl)propanoate |
|---|---|
| PubChem CID | 78058335 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl 3-amino-3-(5-phenylmethoxy-3-pyridinyl)propanoate |
| SMILES | CC(C)(C)OC(=O)CC(N)c1cncc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-19(2,3)24-18(22)10-17(20)15-9-16(12-21-11-15)23-13-14-7-5-4-6-8-14/h4-9,11-12,17H,10,13,20H2,1-3H3 |
| InChIKey | YQNFBAAMVQNXNL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |