C21H27NO2 — CID 135367498
tert-butyl 3-amino-3-[3-[(2-methylphenyl)methyl]phenyl]propanoate (PubChem CID 135367498) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl 3-amino-3-[3-[(2-methylphenyl)methyl]phenyl]propanoate.
| Compound Name | tert-butyl 3-amino-3-[3-[(2-methylphenyl)methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 135367498 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | tert-butyl 3-amino-3-[3-[(2-methylphenyl)methyl]phenyl]propanoate |
| SMILES | Cc1ccccc1Cc1cccc(C(N)CC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H27NO2/c1-15-8-5-6-10-17(15)12-16-9-7-11-18(13-16)19(22)14-20(23)24-21(2,3)4/h5-11,13,19H,12,14,22H2,1-4H3 |
| InChIKey | UVBSXGMJEPPICK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |