C13H17F2NO2 — CID 155971124
tert-butyl (3S)-3-amino-3-(2,6-difluorophenyl)propanoate (PubChem CID 155971124) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is tert-butyl (3S)-3-amino-3-(2,6-difluorophenyl)propanoate.
| Compound Name | tert-butyl (3S)-3-amino-3-(2,6-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 155971124 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | tert-butyl (3S)-3-amino-3-(2,6-difluorophenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](N)c1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2NO2/c1-13(2,3)18-11(17)7-10(16)12-8(14)5-4-6-9(12)15/h4-6,10H,7,16H2,1-3H3/t10-/m0/s1 |
| InChIKey | WFRIKPCQPXEPJS-JTQLQIEISA-N |
| XLogP | 2.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |