C25H30N2O2 — CID 153352746
benzyl (3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoate;ethane (PubChem CID 153352746) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is benzyl (3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoate;ethane.
| Compound Name | benzyl (3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoate;ethane |
|---|---|
| PubChem CID | 153352746 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | benzyl (3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoate;ethane |
| SMILES | CC.Cc1cccc(C)c1-c1cncc([C@H](N)CC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O2.C2H6/c1-16-7-6-8-17(2)23(16)20-11-19(13-25-14-20)21(24)12-22(26)27-15-18-9-4-3-5-10-18;1-2/h3-11,13-14,21H,12,15,24H2,1-2H3;1-2H3/t21-;/m1./s1 |
| InChIKey | DQBOFVBQEJDCOZ-ZMBIFBSDSA-N |
| XLogP | 5.52 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |