C16H18N2O2 — CID 139580030
(3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid (PubChem CID 139580030) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid.
| Compound Name | (3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 139580030 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3R)-3-amino-3-[5-(2,6-dimethylphenyl)-3-pyridinyl]propanoic acid |
| SMILES | Cc1cccc(C)c1-c1cncc([C@H](N)CC(=O)O)c1 |
| InChI | InChI=1S/C16H18N2O2/c1-10-4-3-5-11(2)16(10)13-6-12(8-18-9-13)14(17)7-15(19)20/h3-6,8-9,14H,7,17H2,1-2H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | BJDQBKZXRDCWOM-CQSZACIVSA-N |
| XLogP | 2.84 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |