C17H18FNO2 — CID 135366884
(3S)-3-amino-3-[3-(2,6-dimethylphenyl)-5-fluorophenyl]propanoic acid (PubChem CID 135366884) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is (3S)-3-amino-3-[3-(2,6-dimethylphenyl)-5-fluorophenyl]propanoic acid.
| Compound Name | (3S)-3-amino-3-[3-(2,6-dimethylphenyl)-5-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 135366884 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3S)-3-amino-3-[3-(2,6-dimethylphenyl)-5-fluorophenyl]propanoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(F)cc([C@@H](N)CC(=O)O)c1 |
| InChI | InChI=1S/C17H18FNO2/c1-10-4-3-5-11(2)17(10)13-6-12(7-14(18)8-13)15(19)9-16(20)21/h3-8,15H,9,19H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | IWWBCQBWUFHYDN-HNNXBMFYSA-N |
| XLogP | 3.58 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |