C10H9F4NO2 — CID 79015931
(3S)-3-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 79015931) has the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. Its IUPAC name is (3S)-3-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (3S)-3-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 79015931 |
| Molecular Formula | C10H9F4NO2 |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (3S)-3-amino-3-[3-fluoro-5-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | N[C@@H](CC(=O)O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F4NO2/c11-7-2-5(8(15)4-9(16)17)1-6(3-7)10(12,13)14/h1-3,8H,4,15H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | IWDBIUGBWMUZMF-QMMMGPOBSA-N |
| XLogP | 2.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |